Structure of PDB 8bw4 Chain A Binding Site BS01 |
|
|
Ligand ID | Y3S |
InChI | InChI=1S/C18H20FN3O3S/c1-12-11-21(17(23)16-15(19)7-10-26-16)8-9-22(12)18(24)20-13-3-5-14(25-2)6-4-13/h3-7,10,12H,8-9,11H2,1-2H3,(H,20,24)/t12-/m1/s1 |
InChIKey | IFZPOZKASMLFRK-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1CN(CCN1C(=O)Nc2ccc(cc2)OC)C(=O)c3c(ccs3)F | CACTVS 3.385 | COc1ccc(NC(=O)N2CCN(C[CH]2C)C(=O)c3sccc3F)cc1 | OpenEye OEToolkits 2.0.7 | C[C@@H]1CN(CCN1C(=O)Nc2ccc(cc2)OC)C(=O)c3c(ccs3)F | CACTVS 3.385 | COc1ccc(NC(=O)N2CCN(C[C@H]2C)C(=O)c3sccc3F)cc1 |
|
Formula | C18 H20 F N3 O3 S |
Name | (2R)-4-(3-fluoranylthiophen-2-yl)carbonyl-N-(4-methoxyphenyl)-2-methyl-piperazine-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8bw4 Chain A Residue 1501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|