Structure of PDB 8b99 Chain A Binding Site BS01 |
|
|
Ligand ID | SKE |
InChI | InChI=1S/C15H12F2N6O3S/c16-10-2-1-3-11(17)12(10)13(24)23-14(18)21-15(22-23)20-8-4-6-9(7-5-8)27(19,25)26/h1-7H,(H2,19,25,26)(H3,18,20,21,22) |
InChIKey | KDKUVYLMPJIGKA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(c(c(c1)F)C(=O)n2c(nc(n2)Nc3ccc(cc3)S(=O)(=O)N)N)F | ACDLabs 12.01 | O=C(c1c(F)cccc1F)n2nc(nc2N)Nc3ccc(cc3)S(=O)(=O)N | CACTVS 3.370 | Nc1nc(Nc2ccc(cc2)[S](N)(=O)=O)nn1C(=O)c3c(F)cccc3F |
|
Formula | C15 H12 F2 N6 O3 S |
Name | 4-({5-amino-1-[(2,6-difluorophenyl)carbonyl]-1H-1,2,4-triazol-3-yl}amino)benzenesulfonamide |
ChEMBL | CHEMBL191003 |
DrugBank | |
ZINC | ZINC000003938688
|
PDB chain | 8b99 Chain A Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|