Structure of PDB 8aya Chain A Binding Site BS01 |
|
|
Ligand ID | A1O |
InChI | InChI=1S/C20H24N2O3S/c1-3-12-22-19-10-9-18(13-17(19)8-11-20(22)23)21-26(24,25)14-16-6-4-15(2)5-7-16/h4-7,9-10,13,21H,3,8,11-12,14H2,1-2H3 |
InChIKey | IVHKSUMLZQXFPR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCN1C(=O)CCc2cc(N[S](=O)(=O)Cc3ccc(C)cc3)ccc12 | ACDLabs 12.01 | O=S(=O)(Nc1ccc2c(c1)CCC(=O)N2CCC)Cc3ccc(cc3)C | OpenEye OEToolkits 1.7.6 | CCCN1c2ccc(cc2CCC1=O)NS(=O)(=O)Cc3ccc(cc3)C |
|
Formula | C20 H24 N2 O3 S |
Name | Quinabactin; 1-(4-methylphenyl)-N-(2-oxo-1-propyl-1,2,3,4-tetrahydroquinolin-6-yl)methanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008840608
|
PDB chain | 8aya Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|