Structure of PDB 7xi7 Chain A Binding Site BS01 |
|
|
Ligand ID | 4RI |
InChI | InChI=1S/C16H22N4/c1-2-3-4-8-11-13-14(12-9-6-5-7-10-12)15(17)20-16(18)19-13/h5-7,9-10H,2-4,8,11H2,1H3,(H4,17,18,19,20) |
InChIKey | DBCDYKFZHWOABJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCCCCCc1c(c(nc(n1)N)N)c2ccccc2 | CACTVS 3.385 | CCCCCCc1nc(N)nc(N)c1c2ccccc2 |
|
Formula | C16 H22 N4 |
Name | 6-hexyl-5-phenyl-pyrimidine-2,4-diamine |
ChEMBL | CHEMBL416552 |
DrugBank | |
ZINC | ZINC000013472725
|
PDB chain | 7xi7 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|