Structure of PDB 7xeq Chain A Binding Site BS01 |
|
|
Ligand ID | 9YX |
InChI | InChI=1S/C11H15N2O7PS/c1-5-9(14)8(10-13-7(4-22-10)11(15)16)6(2-12-5)3-20-21(17,18)19/h2,7,10,13-14H,3-4H2,1H3,(H,15,16)(H2,17,18,19)/t7-,10+/m1/s1 |
InChIKey | CXFXHBNEDOKOBZ-XCBNKYQSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)C2NC(CS2)C(=O)O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c([C@H]2N[C@H](CS2)C(O)=O)c1O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c([CH]2N[CH](CS2)C(O)=O)c1O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)[C@H]2N[C@H](CS2)C(=O)O)O |
|
Formula | C11 H15 N2 O7 P S |
Name | (2~{S},4~{S})-2-[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]-1,3-thiazolidine-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013213457
|
PDB chain | 7xeq Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.8.1.7: cysteine desulfurase. |
|
|
|