Structure of PDB 7x6t Chain A Binding Site BS01 |
|
|
Ligand ID | 97F |
InChI | InChI=1S/C21H20N6O2/c1-13(20(22)28)23-18-12-17(26-27-14(2)24-25-21(18)27)16-10-6-7-11-19(16)29-15-8-4-3-5-9-15/h3-13,23H,1-2H3,(H2,22,28)/t13-/m1/s1 |
InChIKey | KJEVFPWGGUKRKQ-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@@H](Nc1cc(nn2c(C)nnc12)c3ccccc3Oc4ccccc4)C(N)=O | OpenEye OEToolkits 2.0.7 | Cc1nnc2n1nc(cc2NC(C)C(=O)N)c3ccccc3Oc4ccccc4 | OpenEye OEToolkits 2.0.7 | Cc1nnc2n1nc(cc2N[C@H](C)C(=O)N)c3ccccc3Oc4ccccc4 | CACTVS 3.385 | C[CH](Nc1cc(nn2c(C)nnc12)c3ccccc3Oc4ccccc4)C(N)=O |
|
Formula | C21 H20 N6 O2 |
Name | (2~{R})-2-[[3-methyl-6-(2-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]amino]propanamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7x6t Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|