Structure of PDB 7um6 Chain A Binding Site BS01 |
|
|
Ligand ID | H8G |
InChI | InChI=1S/C20H26N4O/c1-4-24(5-2)20(25)22-14-10-16-15-7-6-8-17-19(15)13(11-21-17)9-18(16)23(3)12-14/h6-8,10-11,14,18,21H,4-5,9,12H2,1-3H3,(H,22,25)/t14-,18+/m0/s1 |
InChIKey | BKRGVLQUQGGVSM-KBXCAEBGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCN(CC)C(=O)NC1CN(C2Cc3c[nH]c4c3c(ccc4)C2=C1)C | OpenEye OEToolkits 2.0.6 | CCN(CC)C(=O)N[C@@H]1CN([C@@H]2Cc3c[nH]c4c3c(ccc4)C2=C1)C | ACDLabs 12.01 | CCN(CC)C(=O)NC3C=C2c4cccc1c4c(cn1)CC2N(C)C3 | CACTVS 3.385 | CCN(CC)C(=O)N[CH]1CN(C)[CH]2Cc3c[nH]c4cccc(C2=C1)c34 | CACTVS 3.385 | CCN(CC)C(=O)N[C@@H]1CN(C)[C@@H]2Cc3c[nH]c4cccc(C2=C1)c34 |
|
Formula | C20 H26 N4 O |
Name | N,N-diethyl-N'-[(8alpha)-6-methyl-9,10-didehydroergolin-8-yl]urea; lisuride |
ChEMBL | CHEMBL157138 |
DrugBank | DB00589 |
ZINC | ZINC000003831001
|
PDB chain | 7um6 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0007186 |
G protein-coupled receptor signaling pathway |
GO:0007187 |
G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger |
GO:0007189 |
adenylate cyclase-activating G protein-coupled receptor signaling pathway |
GO:0007198 |
adenylate cyclase-inhibiting serotonin receptor signaling pathway |
GO:0007268 |
chemical synaptic transmission |
GO:0021766 |
hippocampus development |
GO:0032355 |
response to estradiol |
|
|