Structure of PDB 7u8s Chain A Binding Site BS01 |
|
|
Ligand ID | LW0 |
InChI | InChI=1S/C17H14FN5O/c18-11-5-3-4-10(8-11)17(24)19-15-9-14(16-20-22-23-21-16)12-6-1-2-7-13(12)15/h1-8,14-15H,9H2,(H,19,24)(H,20,21,22,23)/t14-,15+/m0/s1 |
InChIKey | AVOXPOBGAAXINB-LSDHHAIUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1cccc(c1)C(=O)N[C@@H]2C[C@H](c3[nH]nnn3)c4ccccc24 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)[C@H](C[C@H]2NC(=O)c3cccc(c3)F)c4[nH]nnn4 | ACDLabs 12.01 | Fc1cccc(c1)C(=O)NC1CC(c2nnn[NH]2)c2ccccc12 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)C(CC2NC(=O)c3cccc(c3)F)c4[nH]nnn4 | CACTVS 3.385 | Fc1cccc(c1)C(=O)N[CH]2C[CH](c3[nH]nnn3)c4ccccc24 |
|
Formula | C17 H14 F N5 O |
Name | 3-fluoro-N-[(1R,3S)-3-(1H-tetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000621430161
|
PDB chain | 7u8s Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|