Structure of PDB 7szb Chain A Binding Site BS01 |
|
|
Ligand ID | DQ4 |
InChI | InChI=1S/C13H11N3O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4,14H2,(H,15,17,18)/t9-/m1/s1 |
InChIKey | IICWMVJMJVXCLY-SECBINFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ccc2C(=O)N([CH]3CCC(=O)NC3=O)C(=O)c2c1 | CACTVS 3.385 | Nc1ccc2C(=O)N([C@@H]3CCC(=O)NC3=O)C(=O)c2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1N)C(=O)N(C2=O)C3CCC(=O)NC3=O | ACDLabs 12.01 | O=C1NC(=O)CCC1N1C(=O)c2ccc(N)cc2C1=O | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1N)C(=O)N(C2=O)[C@@H]3CCC(=O)NC3=O |
|
Formula | C13 H11 N3 O4 |
Name | 5-amino-2-[(3R)-2,6-dioxopiperidin-3-yl]-1H-isoindole-1,3(2H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000029389579
|
PDB chain | 7szb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. 3.6.-.- |
|
|
|