Structure of PDB 7rgb Chain A Binding Site BS01 |
|
|
Ligand ID | 4VI |
InChI | InChI=1S/C6H10N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h1,3,7H,2H2,(H,11,12)(H4,8,9,10)/b3-1+,7-4- |
InChIKey | DTYASQOTNAATQJ-QJBDDWKRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C(C=CNC(=N)N)C(=N)C(=O)O | OpenEye OEToolkits 2.0.7 | [H]/N=C(/C/C=C/N/C(=N\[H])/N)\C(=O)O | CACTVS 3.385 | NC(=N)NC=CCC(=N)C(O)=O | CACTVS 3.385 | NC(=N)N/C=C/CC(=N)C(O)=O | ACDLabs 12.01 | N=C(C\C=C\NC(=N)N)C(=O)O |
|
Formula | C6 H10 N4 O2 |
Name | (2Z,4E)-5-carbamimidamido-2-iminopent-4-enoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7rgb Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|