Structure of PDB 7r6z Chain A Binding Site BS01 |
|
|
Ligand ID | 3I0 |
InChI | InChI=1S/C10H9NO7S2/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
InChIKey | APRRQJCCBSJQOQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1c2cc(cc(c2c(cc1S(=O)(=O)O)N)O)S(=O)(=O)O | CACTVS 3.385 | Nc1cc(cc2cc(cc(O)c12)[S](O)(=O)=O)[S](O)(=O)=O | ACDLabs 12.01 | O=S(=O)(O)c1cc2cc(cc(O)c2c(N)c1)S(=O)(=O)O |
|
Formula | C10 H9 N O7 S2 |
Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
ChEMBL | CHEMBL60494 |
DrugBank | |
ZINC | ZINC000001648147
|
PDB chain | 7r6z Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|