Structure of PDB 7qyv Chain A Binding Site BS01 |
|
|
Ligand ID | GJ4 |
InChI | InChI=1S/C21H31N5O3S/c1-4-15-18(14(3)28)13(2)24-19(15)16-12-30-21(25-16)26-9-8-22-11-17(26)20(29)23-7-5-6-10-27/h12,17,22,24,27H,4-11H2,1-3H3,(H,23,29)/t17-/m1/s1 |
InChIKey | BZHIMJWVFLBIRF-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCc1c(c([nH]c1c2csc(n2)N3CCNC[C@@H]3C(=O)NCCCCO)C)C(=O)C | OpenEye OEToolkits 2.0.7 | CCc1c(c([nH]c1c2csc(n2)N3CCNCC3C(=O)NCCCCO)C)C(=O)C | CACTVS 3.385 | CCc1c([nH]c(C)c1C(C)=O)c2csc(n2)N3CCNC[C@@H]3C(=O)NCCCCO | CACTVS 3.385 | CCc1c([nH]c(C)c1C(C)=O)c2csc(n2)N3CCNC[CH]3C(=O)NCCCCO |
|
Formula | C21 H31 N5 O3 S |
Name | (2~{R})-1-[4-(4-ethanoyl-3-ethyl-5-methyl-1~{H}-pyrrol-2-yl)-1,3-thiazol-2-yl]-~{N}-(4-oxidanylbutyl)piperazine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7qyv Chain A Residue 1901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|