Structure of PDB 7o3u Chain A Binding Site BS01 |
|
|
Ligand ID | V1W |
InChI | InChI=1S/C28H21N3O5/c32-20-9-6-18(7-10-20)16-28(36-35)27(34)31-24-13-8-19-15-21(33)11-12-22(19)25(24)29-23(26(31)30-28)14-17-4-2-1-3-5-17/h1-13,15,32-33,35H,14,16H2/t28-/m0/s1 |
InChIKey | ZSLLQPODRCGPLM-NDEPHWFRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OO[C]1(Cc2ccc(O)cc2)N=C3N(C1=O)c4ccc5cc(O)ccc5c4N=C3Cc6ccccc6 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CC2=Nc3c4ccc(cc4ccc3N5C2=N[C@@](C5=O)(Cc6ccc(cc6)O)OO)O | CACTVS 3.385 | OO[C@]1(Cc2ccc(O)cc2)N=C3N(C1=O)c4ccc5cc(O)ccc5c4N=C3Cc6ccccc6 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CC2=Nc3c4ccc(cc4ccc3N5C2=NC(C5=O)(Cc6ccc(cc6)O)OO)O |
|
Formula | C28 H21 N3 O5 |
Name | v-coelenterazine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7o3u Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|