Structure of PDB 7n54 Chain A Binding Site BS01 |
|
|
Ligand ID | 08V |
InChI | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/t15-/m0/s1 |
InChIKey | RUZIUYOSRDWYQF-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CN1CCc2cc(c(c-3c2[C@@H]1Cc4c3cc(c(c4)OC)OC)OC)OC | CACTVS 3.385 | COc1cc2C[C@@H]3N(C)CCc4cc(OC)c(OC)c(c2cc1OC)c34 | OpenEye OEToolkits 2.0.7 | CN1CCc2cc(c(c-3c2C1Cc4c3cc(c(c4)OC)OC)OC)OC | CACTVS 3.385 | COc1cc2C[CH]3N(C)CCc4cc(OC)c(OC)c(c2cc1OC)c34 | ACDLabs 12.01 | COc1cc2c(CC3c4c(CCN3C)cc(OC)c(OC)c24)cc1OC |
|
Formula | C21 H25 N O4 |
Name | glaucine; (6aS,11aM)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
ChEMBL | CHEMBL228082 |
DrugBank | |
ZINC | ZINC000000607911
|
PDB chain | 7n54 Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|