Structure of PDB 7m91 Chain A Binding Site BS01 |
|
|
Ligand ID | YU4 |
InChI | InChI=1S/C23H16ClF3N4O4/c24-15-6-13(7-17(9-15)35-5-3-23(25,26)27)18-8-14(19-11-29-22(34)30-20(19)32)12-31(21(18)33)16-2-1-4-28-10-16/h1-2,4,6-12H,3,5H2,(H2,29,30,32,34) |
InChIKey | BHQBUUBHCKLKLD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC(F)(F)CCOc1cc(Cl)cc(c1)C2=CC(=CN(C2=O)c3cccnc3)C4=CNC(=O)NC4=O | ACDLabs 12.01 | FC(F)(F)CCOc1cc(cc(Cl)c1)C1=CC(=CN(c2cnccc2)C1=O)C1=CNC(=O)NC1=O | OpenEye OEToolkits 2.0.7 | c1cc(cnc1)N2C=C(C=C(C2=O)c3cc(cc(c3)Cl)OCCC(F)(F)F)C4=CNC(=O)NC4=O |
|
Formula | C23 H16 Cl F3 N4 O4 |
Name | 5-{3-[3-chloro-5-(3,3,3-trifluoropropoxy)phenyl]-2-oxo-2H-[1,3'-bipyridin]-5-yl}pyrimidine-2,4(1H,3H)-dione |
ChEMBL | CHEMBL4863054 |
DrugBank | |
ZINC |
|
PDB chain | 7m91 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|