Structure of PDB 7lot Chain A Binding Site BS01 |
|
|
Ligand ID | Y9A |
InChI | InChI=1S/C16H17N5O/c1-12-5-7-13(8-6-12)11-22-15-4-2-3-14(9-15)10-17-16-18-20-21-19-16/h2-9H,10-11H2,1H3,(H2,17,18,19,20,21) |
InChIKey | HREJSYOOKBBZAB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(COc2cccc(CNc3[nH]nnn3)c2)cc1 | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1)COc2cccc(c2)CNc3[nH]nnn3 |
|
Formula | C16 H17 N5 O |
Name | ~{N}-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]-1~{H}-1,2,3,4-tetrazol-5-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004999773
|
PDB chain | 7lot Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|