Structure of PDB 7llh Chain A Binding Site BS01 |
|
|
Ligand ID | IM2 |
InChI | InChI=1S/C12H19N3O4S/c1-7(17)8(5-16)9-4-10(11(15-9)12(18)19)20-3-2-14-6-13/h5-9,15,17H,2-4H2,1H3,(H2,13,14)(H,18,19)/t7-,8-,9-/m1/s1 |
InChIKey | UACUABDJLSUFFC-IWSPIJDZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | [H]/N=C/NCCSC1=C(N[C@H](C1)[C@H](C=O)[C@@H](C)O)C(=O)O | ACDLabs 12.01 | O=C(O)C1=C(SCCNC=[N@H])CC(N1)C(C=O)C(O)C | CACTVS 3.370 | C[C@@H](O)[C@@H](C=O)[C@H]1CC(=C(N1)C(O)=O)SCCNC=N | OpenEye OEToolkits 1.7.6 | CC(C(C=O)C1CC(=C(N1)C(=O)O)SCCNC=N)O | CACTVS 3.370 | C[CH](O)[CH](C=O)[CH]1CC(=C(N1)C(O)=O)SCCNC=N |
|
Formula | C12 H19 N3 O4 S |
Name | (5R)-5-[(1S,2R)-1-formyl-2-hydroxypropyl]-3-[(2-{[(E)-iminomethyl]amino}ethyl)sulfanyl]-4,5-dihydro-1H-pyrrole-2-carbox ylic acid; IMIPENEM, open form; N-FORMIMIDOYL-THIENAMYCINE, open form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103040234
|
PDB chain | 7llh Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|