Structure of PDB 7l8o Chain A Binding Site BS01 |
|
|
Ligand ID | XV7 |
InChI | InChI=1S/C13H10O6S2/c14-20(15,16)10-1-3-12-8(6-10)5-9-7-11(21(17,18)19)2-4-13(9)12/h1-4,6-7H,5H2,(H,14,15,16)(H,17,18,19) |
InChIKey | WBJRJWHBYUAEQD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c12c(ccc(S(O)(=O)=O)c1)c3ccc(cc3C2)S(O)(=O)=O | CACTVS 3.385 | O[S](=O)(=O)c1ccc2c(Cc3cc(ccc23)[S](O)(=O)=O)c1 | OpenEye OEToolkits 2.0.7 | c1cc-2c(cc1S(=O)(=O)O)Cc3c2ccc(c3)S(=O)(=O)O |
|
Formula | C13 H10 O6 S2 |
Name | 9H-fluorene-2,7-disulfonate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002507827
|
PDB chain | 7l8o Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.2.6: beta-lactamase. |
|
|
|