Structure of PDB 7kvo Chain A Binding Site BS01 |
|
|
Ligand ID | HEM |
InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
InChIKey | KABFMIBPWCXCRK-RGGAHWMASA-L |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O | CACTVS 3.385 | CC1=C(CCC(O)=O)C2=Cc3n4[Fe]5|6|N2=C1C=c7n5c(=CC8=N|6C(=Cc4c(C)c3CCC(O)=O)C(=C8C=C)C)c(C)c7C=C | ACDLabs 12.01 | C=1c3c(c(c4C=C5C(=C(C=6C=C7C(=C(C8=CC=2C(=C(C=1N=2[Fe](n34)(N5=6)N78)CCC(=O)O)C)\C=C)C)\C=C)C)C)CCC(=O)O |
|
Formula | C34 H32 Fe N4 O4 |
Name | PROTOPORPHYRIN IX CONTAINING FE; HEME |
ChEMBL | |
DrugBank | DB18267 |
ZINC |
|
PDB chain | 7kvo Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005496 |
steroid binding |
GO:0005506 |
iron ion binding |
GO:0005515 |
protein binding |
GO:0008395 |
steroid hydroxylase activity |
GO:0008401 |
retinoic acid 4-hydroxylase activity |
GO:0016491 |
oxidoreductase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0019825 |
oxygen binding |
GO:0019899 |
enzyme binding |
GO:0020037 |
heme binding |
GO:0030343 |
vitamin D3 25-hydroxylase activity |
GO:0034875 |
caffeine oxidase activity |
GO:0046872 |
metal ion binding |
GO:0050591 |
quinine 3-monooxygenase activity |
GO:0050649 |
testosterone 6-beta-hydroxylase activity |
GO:0062181 |
1-alpha,25-dihydroxyvitamin D3 23-hydroxylase activity |
GO:0062187 |
anandamide 8,9 epoxidase activity |
GO:0062188 |
anandamide 11,12 epoxidase activity |
GO:0062189 |
anandamide 14,15 epoxidase activity |
GO:0070330 |
aromatase activity |
GO:0070576 |
vitamin D 24-hydroxylase activity |
GO:0101020 |
estrogen 16-alpha-hydroxylase activity |
GO:0101021 |
estrogen 2-hydroxylase activity |
GO:0102320 |
1,8-cineole 2-exo-monooxygenase activity |
|
|