Structure of PDB 7kol Chain A Binding Site BS01 |
|
|
Ligand ID | Y96 |
InChI | InChI=1S/C21H20N2O2/c1-14-10-11-16(13-22-25)12-20(14)21(24)23-15(2)18-9-5-7-17-6-3-4-8-19(17)18/h3-13,15,25H,1-2H3,(H,23,24)/b22-13+/t15-/m1/s1 |
InChIKey | UTAGJMUNTWRPTE-IKMPRTQCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c1c(ccc(\C=N\O)c1)C)NC(C)c2cccc3c2cccc3 | CACTVS 3.385 | C[C@@H](NC(=O)c1cc(ccc1C)\C=N\O)c2cccc3ccccc23 | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1C(=O)NC(C)c2cccc3c2cccc3)C=NO | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1C(=O)N[C@H](C)c2cccc3c2cccc3)/C=N/O | CACTVS 3.385 | C[CH](NC(=O)c1cc(ccc1C)C=NO)c2cccc3ccccc23 |
|
Formula | C21 H20 N2 O2 |
Name | 5-[(E)-(hydroxyimino)methyl]-2-methyl-N-[(1R)-1-(naphthalen-1-yl)ethyl]benzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7kol Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|