Structure of PDB 7jxx Chain A Binding Site BS01 |
|
|
Ligand ID | VP7 |
InChI | InChI=1S/C20H20N4O/c1-20(2,25)9-8-12-6-7-15-14(10-12)17-16(23-15)5-3-4-13-11-22-19(21)24-18(13)17/h6-7,10-11,23,25H,3-5H2,1-2H3,(H2,21,22,24) |
InChIKey | DGLFSNZWRYADFC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n1cc2c(nc1N)c3c(CCC2)nc4c3cc(C#CC(C)(C)O)cc4 | CACTVS 3.385 | CC(C)(O)C#Cc1ccc2[nH]c3CCCc4cnc(N)nc4c3c2c1 | OpenEye OEToolkits 2.0.7 | CC(C)(C#Cc1ccc2c(c1)c-3c([nH]2)CCCc4c3nc(nc4)N)O |
|
Formula | C20 H20 N4 O |
Name | 4-(2-amino-5,6,7,8-tetrahydropyrimido[4',5':3,4]cyclohepta[1,2-b]indol-11-yl)-2-methylbut-3-yn-2-ol |
ChEMBL | CHEMBL2334586 |
DrugBank | |
ZINC | ZINC000095589024
|
PDB chain | 7jxx Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|