Structure of PDB 7ju7 Chain A Binding Site BS01 |
|
|
Ligand ID | G65 |
InChI | InChI=1S/C28H30N6OS/c1-20-5-10-24(16-25(20)31-28-32-26(19-36-28)23-4-3-11-29-17-23)30-27(35)22-8-6-21(7-9-22)18-34-14-12-33(2)13-15-34/h3-11,16-17,19H,12-15,18H2,1-2H3,(H,30,35)(H,31,32) |
InChIKey | WJEOLQLKVOPQFV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1ccc(cc1Nc2nc(cs2)c3cccnc3)NC(=O)c4ccc(cc4)CN5CCN(CC5)C | CACTVS 3.385 | CN1CCN(CC1)Cc2ccc(cc2)C(=O)Nc3ccc(C)c(Nc4scc(n4)c5cccnc5)c3 |
|
Formula | C28 H30 N6 O S |
Name | Masitinib |
ChEMBL | CHEMBL1908391 |
DrugBank | DB11526 |
ZINC | ZINC000034177219
|
PDB chain | 7ju7 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|