Structure of PDB 7jfy Chain A Binding Site BS01 |
|
|
Ligand ID | V91 |
InChI | InChI=1S/C16H18N4O2S2/c21-14(11-2-1-5-17-11)19-13-4-3-12(24-13)16(22)20-8-10(9-20)15-18-6-7-23-15/h3-4,6-7,10-11,17H,1-2,5,8-9H2,(H,19,21)/t11-/m0/s1 |
InChIKey | XXEFZFWFYAPRID-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(Nc1sc(cc1)C(=O)N2CC(C2)c3sccn3)[CH]4CCCN4 | CACTVS 3.385 | O=C(Nc1sc(cc1)C(=O)N2CC(C2)c3sccn3)[C@@H]4CCCN4 | OpenEye OEToolkits 2.0.7 | c1cc(sc1C(=O)N2CC(C2)c3nccs3)NC(=O)[C@@H]4CCCN4 | OpenEye OEToolkits 2.0.7 | c1cc(sc1C(=O)N2CC(C2)c3nccs3)NC(=O)C4CCCN4 | ACDLabs 12.01 | C(C1CCCN1)(Nc4ccc(C(N2CC(C2)c3nccs3)=O)s4)=O |
|
Formula | C16 H18 N4 O2 S2 |
Name | N-(5-{3-[(2S)-1,3-thiazolidin-2-yl]azetidine-1-carbonyl}thiophen-2-yl)-L-prolinamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7jfy Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|