Structure of PDB 7h48 Chain A Binding Site BS01 |
|
|
Ligand ID | RZJ |
InChI | InChI=1S/C10H14N2O2S/c1-12-6-2-3-8-4-5-9(7-10(8)12)15(11,13)14/h4-5,7H,2-3,6H2,1H3,(H2,11,13,14) |
InChIKey | OUJFDUTZTPBMDN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CN1CCCc2c1cc(cc2)S(=O)(=O)N | CACTVS 3.385 | CN1CCCc2ccc(cc12)[S](N)(=O)=O |
|
Formula | C10 H14 N2 O2 S |
Name | 1-methyl-3,4-dihydro-2~{H}-quinoline-7-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000074941908
|
PDB chain | 7h48 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|