Structure of PDB 7h04 Chain A Binding Site BS01 |
|
|
Ligand ID | A1AJW |
InChI | InChI=1S/C11H16N4O/c1-7(2)9(5-16)15-11-8-3-4-12-10(8)13-6-14-11/h3-4,6-7,9,16H,5H2,1-2H3,(H2,12,13,14,15)/t9-/m0/s1 |
InChIKey | UQNGWKIAUTZMKI-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)C(CO)Nc1c2cc[nH]c2ncn1 | OpenEye OEToolkits 2.0.7 | CC(C)[C@H](CO)Nc1c2cc[nH]c2ncn1 | CACTVS 3.385 | CC(C)[CH](CO)Nc1ncnc2[nH]ccc12 | CACTVS 3.385 | CC(C)[C@H](CO)Nc1ncnc2[nH]ccc12 | ACDLabs 12.01 | CC(C)C(CO)Nc1ncnc2[NH]ccc21 |
|
Formula | C11 H16 N4 O |
Name | (2R)-3-methyl-2-[(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]butan-1-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7h04 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|