Structure of PDB 7gzh Chain A Binding Site BS01 |
|
|
Ligand ID | A1AKQ |
InChI | InChI=1S/C17H14BrN3O3/c18-13-3-1-10(2-4-13)14(8-15(22)23)21-17(24)12-7-11-5-6-19-16(11)20-9-12/h1-7,9,14H,8H2,(H,19,20)(H,21,24)(H,22,23)/t14-/m1/s1 |
InChIKey | QCHNMSZXYHCZMN-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Brc1ccc(cc1)C(CC(=O)O)NC(=O)c1cc2cc[NH]c2nc1 | OpenEye OEToolkits 2.0.7 | c1cc(ccc1C(CC(=O)O)NC(=O)c2cc3cc[nH]c3nc2)Br | OpenEye OEToolkits 2.0.7 | c1cc(ccc1[C@H](CC(=O)O)NC(=O)c2cc3cc[nH]c3nc2)Br | CACTVS 3.385 | OC(=O)C[CH](NC(=O)c1cnc2[nH]ccc2c1)c3ccc(Br)cc3 | CACTVS 3.385 | OC(=O)C[C@H](NC(=O)c1cnc2[nH]ccc2c1)c3ccc(Br)cc3 |
|
Formula | C17 H14 Br N3 O3 |
Name | (3R)-3-(4-bromophenyl)-3-[(1H-pyrrolo[2,3-b]pyridine-5-carbonyl)amino]propanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gzh Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|