Structure of PDB 7gz9 Chain A Binding Site BS01 |
|
|
Ligand ID | A1AJX |
InChI | InChI=1S/C11H15N5O/c1-6(2)8(9(12)17)16-11-7-3-4-13-10(7)14-5-15-11/h3-6,8H,1-2H3,(H2,12,17)(H2,13,14,15,16)/t8-/m1/s1 |
InChIKey | RBCLNCQDYKLDOO-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[C@@H](Nc1ncnc2[nH]ccc12)C(N)=O | CACTVS 3.385 | CC(C)[CH](Nc1ncnc2[nH]ccc12)C(N)=O | ACDLabs 12.01 | NC(=O)C(Nc1ncnc2[NH]ccc21)C(C)C | OpenEye OEToolkits 2.0.7 | CC(C)[C@H](C(=O)N)Nc1c2cc[nH]c2ncn1 | OpenEye OEToolkits 2.0.7 | CC(C)C(C(=O)N)Nc1c2cc[nH]c2ncn1 |
|
Formula | C11 H15 N5 O |
Name | N~2~-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-D-valinamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gz9 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|