Structure of PDB 7gol Chain A Binding Site BS01 |
|
|
Ligand ID | U9R |
InChI | InChI=1S/C8H11N3O2S/c1-5-2-3-13-7(5)8(12)10-6-4-9-11-14-6/h4-5,7H,2-3H2,1H3,(H,10,12)/t5-,7+/m1/s1 |
InChIKey | OAYBAYPFIGUPDE-VDTYLAMSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C[C@@H]1CCO[C@@H]1C(=O)Nc2cnns2 | CACTVS 3.385 | C[CH]1CCO[CH]1C(=O)Nc2snnc2 | OpenEye OEToolkits 2.0.7 | CC1CCOC1C(=O)Nc2cnns2 | ACDLabs 12.01 | O=C(Nc1cnns1)C1OCCC1C | CACTVS 3.385 | C[C@@H]1CCO[C@@H]1C(=O)Nc2snnc2 |
|
Formula | C8 H11 N3 O2 S |
Name | (2S,3R)-3-methyl-N-(1,2,3-thiadiazol-5-yl)oxolane-2-carboxamide (non-preferred name) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000225578129
|
PDB chain | 7gol Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|