Structure of PDB 7gkm Chain A Binding Site BS01 |
|
|
Ligand ID | QY6 |
InChI | InChI=1S/C22H20ClN3O/c23-16-6-7-19-18(12-16)22(9-10-25-19)8-3-11-26(21(22)27)20-14-24-13-15-4-1-2-5-17(15)20/h1-2,4-7,12-14,25H,3,8-11H2/t22-/m1/s1 |
InChIKey | GMEVLWIDIJTOMX-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3CCC[C@@]4(C3=O)CCNc5c4cc(cc5)Cl | ACDLabs 12.01 | O=C1N(CCCC11CCNc2ccc(Cl)cc21)c1cncc2ccccc21 | CACTVS 3.385 | Clc1ccc2NCC[C@]3(CCCN(C3=O)c4cncc5ccccc45)c2c1 | CACTVS 3.385 | Clc1ccc2NCC[C]3(CCCN(C3=O)c4cncc5ccccc45)c2c1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3CCCC4(C3=O)CCNc5c4cc(cc5)Cl |
|
Formula | C22 H20 Cl N3 O |
Name | (3R)-6'-chloro-1-(isoquinolin-4-yl)-2',3'-dihydro-1'H-spiro[piperidine-3,4'-quinolin]-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gkm Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|