Structure of PDB 7gk6 Chain A Binding Site BS01 |
|
|
Ligand ID | QTL |
InChI | InChI=1S/C19H16ClN3O/c20-14-6-5-12-7-8-22-18(16(12)9-14)19(24)23-17-11-21-10-13-3-1-2-4-15(13)17/h1-6,9-11,18,22H,7-8H2,(H,23,24)/t18-/m1/s1 |
InChIKey | RTYGDBGOBVKIGM-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc2CCN[CH](C(=O)Nc3cncc4ccccc34)c2c1 | CACTVS 3.385 | Clc1ccc2CCN[C@@H](C(=O)Nc3cncc4ccccc34)c2c1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2NC(=O)C3c4cc(ccc4CCN3)Cl | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2NC(=O)[C@H]3c4cc(ccc4CCN3)Cl | ACDLabs 12.01 | Clc1ccc2CCNC(c2c1)C(=O)Nc1cncc2ccccc21 |
|
Formula | C19 H16 Cl N3 O |
Name | (1R)-7-chloro-N-(isoquinolin-4-yl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gk6 Chain A Residue 408
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|