Structure of PDB 7gk3 Chain A Binding Site BS01 |
|
|
Ligand ID | QT3 |
InChI | InChI=1S/C20H18ClN3O/c1-24-9-8-13-6-7-15(21)10-17(13)19(24)20(25)23-18-12-22-11-14-4-2-3-5-16(14)18/h2-7,10-12,19H,8-9H2,1H3,(H,23,25)/t19-/m1/s1 |
InChIKey | NHDKKXCWRNZVNJ-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CN1CCc2ccc(cc2[C@@H]1C(=O)Nc3cncc4c3cccc4)Cl | ACDLabs 12.01 | Clc1ccc2CCN(C)C(c2c1)C(=O)Nc1cncc2ccccc21 | CACTVS 3.385 | CN1CCc2ccc(Cl)cc2[CH]1C(=O)Nc3cncc4ccccc34 | CACTVS 3.385 | CN1CCc2ccc(Cl)cc2[C@@H]1C(=O)Nc3cncc4ccccc34 | OpenEye OEToolkits 2.0.7 | CN1CCc2ccc(cc2C1C(=O)Nc3cncc4c3cccc4)Cl |
|
Formula | C20 H18 Cl N3 O |
Name | (1R)-7-chloro-N-(isoquinolin-4-yl)-2-methyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gk3 Chain A Residue 408
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|