Structure of PDB 7gjc Chain A Binding Site BS01 |
|
|
Ligand ID | QM3 |
InChI | InChI=1S/C21H15ClN2O3/c22-14-5-6-18-16(9-14)21(7-8-27-18)10-19(25)24(20(21)26)17-12-23-11-13-3-1-2-4-15(13)17/h1-6,9,11-12H,7-8,10H2/t21-/m0/s1 |
InChIKey | QOLVOMOIQPMUFC-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3C(=O)C[C@@]4(C3=O)CCOc5c4cc(cc5)Cl | CACTVS 3.385 | Clc1ccc2OCC[C]3(CC(=O)N(C3=O)c4cncc5ccccc45)c2c1 | CACTVS 3.385 | Clc1ccc2OCC[C@]3(CC(=O)N(C3=O)c4cncc5ccccc45)c2c1 | ACDLabs 12.01 | Clc1ccc2OCCC3(CC(=O)N(C3=O)c3cncc4ccccc43)c2c1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3C(=O)CC4(C3=O)CCOc5c4cc(cc5)Cl |
|
Formula | C21 H15 Cl N2 O3 |
Name | (1'P,3'S)-6-chloro-1'-(isoquinolin-4-yl)-2,3-dihydrospiro[[1]benzopyran-4,3'-pyrrolidine]-2',5'-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gjc Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|