Structure of PDB 7gi4 Chain A Binding Site BS01 |
|
|
Ligand ID | QCC |
InChI | InChI=1S/C17H16ClN3O3/c1-10-2-3-19-9-14(10)20-15(22)6-11-4-12(18)7-13(5-11)24-17-8-16(23)21-17/h2-5,7,9,17H,6,8H2,1H3,(H,20,22)(H,21,23)/t17-/m0/s1 |
InChIKey | JCZDGTYSQGAPDN-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccncc1NC(=O)Cc2cc(Cl)cc(O[CH]3CC(=O)N3)c2 | ACDLabs 12.01 | Cc1ccncc1NC(=O)Cc1cc(Cl)cc(OC2CC(=O)N2)c1 | OpenEye OEToolkits 2.0.7 | Cc1ccncc1NC(=O)Cc2cc(cc(c2)Cl)OC3CC(=O)N3 | OpenEye OEToolkits 2.0.7 | Cc1ccncc1NC(=O)Cc2cc(cc(c2)Cl)O[C@H]3CC(=O)N3 | CACTVS 3.385 | Cc1ccncc1NC(=O)Cc2cc(Cl)cc(O[C@H]3CC(=O)N3)c2 |
|
Formula | C17 H16 Cl N3 O3 |
Name | 2-(3-chloro-5-{[(2S)-4-oxoazetidin-2-yl]oxy}phenyl)-N-(4-methylpyridin-3-yl)acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gi4 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|