Structure of PDB 7gho Chain A Binding Site BS01 |
|
|
Ligand ID | QC3 |
InChI | InChI=1S/C19H15ClN2O/c20-15-6-3-5-13(10-15)17-8-9-22(19(17)23)18-12-21-11-14-4-1-2-7-16(14)18/h1-7,10-12,17H,8-9H2/t17-/m0/s1 |
InChIKey | RNKBROMGPBKNFK-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3CC[C@H](C3=O)c4cccc(c4)Cl | CACTVS 3.385 | Clc1cccc(c1)[CH]2CCN(C2=O)c3cncc4ccccc34 | CACTVS 3.385 | Clc1cccc(c1)[C@@H]2CCN(C2=O)c3cncc4ccccc34 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)cncc2N3CCC(C3=O)c4cccc(c4)Cl | ACDLabs 12.01 | Clc1cccc(c1)C1CCN(c2cncc3ccccc23)C1=O |
|
Formula | C19 H15 Cl N2 O |
Name | (3S)-3-(3-chlorophenyl)-1-(isoquinolin-4-yl)pyrrolidin-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gho Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|