Structure of PDB 7gfw Chain A Binding Site BS01 |
|
|
Ligand ID | OK9 |
InChI | InChI=1S/C16H16N2O3S2/c19-11-12(17-16(20)14-2-1-9-22-14)10-13-3-4-15(23-13)18-5-7-21-8-6-18/h1-4,9-11H,5-8H2,(H,17,20)/b12-10- |
InChIKey | KZHJLIYVOMIHCX-BENRWUELSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=CC(/NC(=O)c1sccc1)=C/c2sc(cc2)N3CCOCC3 | CACTVS 3.385 | O=CC(NC(=O)c1sccc1)=Cc2sc(cc2)N3CCOCC3 | OpenEye OEToolkits 2.0.7 | c1cc(sc1)C(=O)N/C(=C\c2ccc(s2)N3CCOCC3)/C=O | OpenEye OEToolkits 2.0.7 | c1cc(sc1)C(=O)NC(=Cc2ccc(s2)N3CCOCC3)C=O | ACDLabs 12.01 | O=C\C(NC(=O)c1cccs1)=C\c1ccc(s1)N1CCOCC1 |
|
Formula | C16 H16 N2 O3 S2 |
Name | N-{(1Z)-1-[5-(morpholin-4-yl)thiophen-2-yl]-3-oxoprop-1-en-2-yl}thiophene-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gfw Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|