Structure of PDB 7gdp Chain A Binding Site BS01 |
|
|
Ligand ID | MVX |
InChI | InChI=1S/C14H13ClN4O2/c15-8-1-4-12-10(5-8)11(6-21-12)13(20)17-14-18-16-7-19(14)9-2-3-9/h1,4-5,7,9,11H,2-3,6H2,(H,17,18,20)/t11-/m1/s1 |
InChIKey | UWYNTVRTJWFJEK-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc2OC[CH](C(=O)Nc3nncn3C4CC4)c2c1 | CACTVS 3.385 | Clc1ccc2OC[C@@H](C(=O)Nc3nncn3C4CC4)c2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1Cl)[C@@H](CO2)C(=O)Nc3nncn3C4CC4 | ACDLabs 12.01 | Clc1cc2c(cc1)OCC2C(=O)Nc1nncn1C1CC1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1Cl)C(CO2)C(=O)Nc3nncn3C4CC4 |
|
Formula | C14 H13 Cl N4 O2 |
Name | (3S)-5-chloro-N-(4-cyclopropyl-4H-1,2,4-triazol-3-yl)-2,3-dihydro-1-benzofuran-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gdp Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|