Structure of PDB 7gcp Chain A Binding Site BS01 |
|
|
Ligand ID | LM0 |
InChI | InChI=1S/C14H17N3O3/c1-9(18)15-16-14(20)13-7-11-5-3-4-6-12(11)8-17(13)10(2)19/h3-6,13H,7-8H2,1-2H3,(H,15,18)(H,16,20)/t13-/m0/s1 |
InChIKey | SATVLGDJXZFYJA-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=O)NNC(=O)[C@@H]1Cc2ccccc2CN1C(=O)C | OpenEye OEToolkits 2.0.7 | CC(=O)NNC(=O)C1Cc2ccccc2CN1C(=O)C | CACTVS 3.385 | CC(=O)NNC(=O)[C@@H]1Cc2ccccc2CN1C(C)=O | ACDLabs 12.01 | CC(=O)NNC(=O)C1Cc2ccccc2CN1C(C)=O | CACTVS 3.385 | CC(=O)NNC(=O)[CH]1Cc2ccccc2CN1C(C)=O |
|
Formula | C14 H17 N3 O3 |
Name | (3S)-N',2-diacetyl-1,2,3,4-tetrahydroisoquinoline-3-carbohydrazide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7gcp Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|