Structure of PDB 7fvl Chain A Binding Site BS01 |
|
|
Ligand ID | ZP0 |
InChI | InChI=1S/C19H27N3O5/c1-19(2)13-26-16(12-27-19)11-20-18(25)22-8-6-21(7-9-22)17(24)14-4-3-5-15(23)10-14/h3-5,10,16,23H,6-9,11-13H2,1-2H3,(H,20,25)/t16-/m0/s1 |
InChIKey | ZRUCPOGUOWXAIC-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1(C)CO[C@@H](CNC(=O)N2CCN(CC2)C(=O)c3cccc(O)c3)CO1 | CACTVS 3.385 | CC1(C)CO[CH](CNC(=O)N2CCN(CC2)C(=O)c3cccc(O)c3)CO1 | OpenEye OEToolkits 2.0.7 | CC1(COC(CO1)CNC(=O)N2CCN(CC2)C(=O)c3cccc(c3)O)C | ACDLabs 12.01 | Oc1cccc(c1)C(=O)N1CCN(CC1)C(=O)NCC1OCC(C)(C)OC1 | OpenEye OEToolkits 2.0.7 | CC1(CO[C@H](CO1)CNC(=O)N2CCN(CC2)C(=O)c3cccc(c3)O)C |
|
Formula | C19 H27 N3 O5 |
Name | N-{[(2S)-5,5-dimethyl-1,4-dioxan-2-yl]methyl}-4-(3-hydroxybenzoyl)piperazine-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7fvl Chain A Residue 1901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|