Structure of PDB 7fv7 Chain A Binding Site BS01 |
|
|
Ligand ID | ZL3 |
InChI | InChI=1S/C14H21N3O3/c1-10(2)15-14(19)16-6-7-17(11(3)9-16)13(18)12-5-4-8-20-12/h4-5,8,10-11H,6-7,9H2,1-3H3,(H,15,19)/t11-/m1/s1 |
InChIKey | VFOPSAKXHHWNTF-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1CN(CCN1C(=O)c2ccco2)C(=O)NC(C)C | CACTVS 3.385 | CC(C)NC(=O)N1CCN([CH](C)C1)C(=O)c2occc2 | CACTVS 3.385 | CC(C)NC(=O)N1CCN([C@@H](C)C1)C(=O)c2occc2 | ACDLabs 12.01 | O=C(N1CCN(CC1C)C(=O)NC(C)C)c1ccco1 | OpenEye OEToolkits 2.0.7 | C[C@H]1CN(CCN1C(=O)c2ccco2)C(=O)NC(C)C |
|
Formula | C14 H21 N3 O3 |
Name | (3R)-4-(furan-2-carbonyl)-3-methyl-N-(propan-2-yl)piperazine-1-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7fv7 Chain A Residue 1501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|