Structure of PDB 7fea Chain A Binding Site BS01 |
|
|
Ligand ID | 3KI |
InChI | InChI=1S/C16H20O4/c1-2-3-4-5-6-7-8-11-14(17)15(18)12-9-10-13-16(19)20/h2,7-8,14-15,17-18H,1,9-13H2,(H,19,20)/b8-7+/t14-,15-/m1/s1 |
InChIKey | JBBDMFIFQBMXHD-FHFZEBMASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C=CC#CC#C/C=C/C[C@H]([C@@H](CCCCC(=O)O)O)O | OpenEye OEToolkits 2.0.7 | C=CC#CC#CC=CCC(C(CCCCC(=O)O)O)O | CACTVS 3.385 | O[CH](CCCCC(O)=O)[CH](O)CC=CC#CC#CC=C | CACTVS 3.385 | O[C@H](CCCCC(O)=O)[C@H](O)C/C=C/C#CC#CC=C |
|
Formula | C16 H20 O4 |
Name | (6~{R},7~{R},9~{E})-6,7-bis(oxidanyl)hexadeca-9,15-dien-11,13-diynoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7fea Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|