Structure of PDB 7efq Chain A Binding Site BS01 |
|
|
Ligand ID | J3F |
InChI | InChI=1S/C26H29N3O5S/c1-4-29(5-2)18-8-11-20-21(16-24(30)34-22(20)15-18)28(3)12-13-33-19-9-6-17(7-10-19)14-23-25(31)27-26(32)35-23/h6-11,15-16,23H,4-5,12-14H2,1-3H3,(H,27,31,32)/t23-/m0/s1 |
InChIKey | LTRSSWCLZRFXEC-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCN(CC)c1ccc2c(c1)OC(=O)C=C2N(C)CCOc3ccc(cc3)CC4C(=O)NC(=O)S4 | OpenEye OEToolkits 2.0.7 | CCN(CC)c1ccc2c(c1)OC(=O)C=C2N(C)CCOc3ccc(cc3)C[C@H]4C(=O)NC(=O)S4 | CACTVS 3.385 | CCN(CC)c1ccc2c(OC(=O)C=C2N(C)CCOc3ccc(C[CH]4SC(=O)NC4=O)cc3)c1 | CACTVS 3.385 | CCN(CC)c1ccc2c(OC(=O)C=C2N(C)CCOc3ccc(C[C@@H]4SC(=O)NC4=O)cc3)c1 |
|
Formula | C26 H29 N3 O5 S |
Name | (5S)-5-[[4-[2-[[7-(diethylamino)-2-oxidanylidene-chromen-4-yl]-methyl-amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7efq Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|