Structure of PDB 7dn4 Chain A Binding Site BS01 |
|
|
Ligand ID | JC3 |
InChI | InChI=1S/C20H26N4O/c1-23-12-15(14-7-4-3-5-8-14)11-16(13-23)21-20-22-18-10-6-9-17(18)19(25)24(20)2/h3-5,7-8,15-16H,6,9-13H2,1-2H3,(H,21,22)/t15-,16+/m0/s1 |
InChIKey | PUACXQJMNIDQMB-JKSUJKDBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C[CH](C[CH](C1)c2ccccc2)NC3=NC4=C(CCC4)C(=O)N3C | OpenEye OEToolkits 2.0.7 | CN1C[C@H](C[C@H](C1)NC2=NC3=C(CCC3)C(=O)N2C)c4ccccc4 | OpenEye OEToolkits 2.0.7 | CN1CC(CC(C1)NC2=NC3=C(CCC3)C(=O)N2C)c4ccccc4 | CACTVS 3.385 | CN1C[C@@H](C[C@@H](C1)c2ccccc2)NC3=NC4=C(CCC4)C(=O)N3C |
|
Formula | C20 H26 N4 O |
Name | 3-methyl-2-[[(3R,5R)-1-methyl-5-phenyl-piperidin-3-yl]amino]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
ChEMBL | CHEMBL4846718 |
DrugBank | |
ZINC |
|
PDB chain | 7dn4 Chain A Residue 3001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|