Structure of PDB 7db7 Chain A Binding Site BS01 |
|
|
Ligand ID | H2L |
InChI | InChI=1S/C20H19N5O3S2/c26-19(25-20-21-10-11-29-20)24-15-4-3-5-16(12-15)30(27,28)23-9-8-14-13-22-18-7-2-1-6-17(14)18/h1-7,10-13,22-23H,8-9H2,(H2,21,24,25,26) |
InChIKey | NYYVMDXWTXBRNW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c[nH]2)CCNS(=O)(=O)c3cccc(c3)NC(=O)Nc4nccs4 | CACTVS 3.385 | O=C(Nc1sccn1)Nc2cccc(c2)[S](=O)(=O)NCCc3c[nH]c4ccccc34 |
|
Formula | C20 H19 N5 O3 S2 |
Name | 1-[3-[2-(1H-indol-3-yl)ethylsulfamoyl]phenyl]-3-(1,3-thiazol-2-yl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003989251
|
PDB chain | 7db7 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
6.1.1.20: phenylalanine--tRNA ligase. |
|
|
|