Structure of PDB 7d2a Chain A Binding Site BS01 |
|
|
Ligand ID | MAW |
InChI | InChI=1S/C6H8O6/c7-2-1-3(5(9)10)12-6(11)4(2)8/h1-2,4,6-8,11H,(H,9,10)/t2-,4-,6+/m0/s1 |
InChIKey | IAKKJSVSFCTLRY-NVFHJIOMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C1=C(OC(C(C1O)O)O)C(=O)O | OpenEye OEToolkits 2.0.7 | C1=C(O[C@H]([C@H]([C@H]1O)O)O)C(=O)O | CACTVS 3.385 | O[CH]1OC(=C[CH](O)[CH]1O)C(O)=O | ACDLabs 12.01 | OC1C(O)C(O)C=C(O1)C(=O)O | CACTVS 3.385 | O[C@@H]1OC(=C[C@H](O)[C@@H]1O)C(O)=O |
|
Formula | C6 H8 O6 |
Name | 4-deoxy-alpha-L-erythro-hex-4-enopyranuronic acid; 4-deoxy-alpha-L-erythro-hex-4-enuronic acid; 4-deoxy-L-erythro-hex-4-enuronic acid; 4-deoxy-erythro-hex-4-enuronic acid |
ChEMBL | |
DrugBank | DB02734 |
ZINC |
|
PDB chain | 7d2a Chain C Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|