Structure of PDB 7bnd Chain A Binding Site BS01 |
|
|
Ligand ID | U5E |
InChI | InChI=1S/C14H13NOS/c1-15-14(16)12-8-10-7-6-9-4-2-3-5-11(9)13(10)17-12/h2-5,8H,6-7H2,1H3,(H,15,16) |
InChIKey | ADOUOUVBTDMDIV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CNC(=O)c1cc2c(s1)-c3ccccc3CC2 | CACTVS 3.385 | CNC(=O)c1sc2c(CCc3ccccc23)c1 |
|
Formula | C14 H13 N O S |
Name | N-methyl-4,5-dihydrobenzo[g]benzothiophene-2-carboxamide; ~{N}-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide; N-methyl-4,5-dihydrobenzo[g][1]benzothiole-2-carboxamide; N-Methyl-4,5-dihydronaphtho[1,2-b]thiophene-2-carboxamide; N-methyl-4,5-dihydrobenzo[g]benzothiophene-2-carboxamide; N-methyl-4H,5H-naphtho[1,2-b]thiophene-2-carboxamide |
ChEMBL | CHEMBL1560359 |
DrugBank | |
ZINC | ZINC000001405579
|
PDB chain | 7bnd Chain A Residue 508
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.1.98: [Wnt protein] O-palmitoleoyl-L-serine hydrolase. |
|
|
|