Structure of PDB 7bn8 Chain A Binding Site BS01 |
|
|
Ligand ID | U4T |
InChI | InChI=1S/C13H10O2S/c14-13(15)11-7-9-6-5-8-3-1-2-4-10(8)12(9)16-11/h1-4,7H,5-6H2,(H,14,15) |
InChIKey | IGBRCZHGFVMFCR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc-2c(c1)CCc3c2sc(c3)C(=O)O | CACTVS 3.385 | OC(=O)c1sc2c(CCc3ccccc23)c1 |
|
Formula | C13 H10 O2 S |
Name | 4H,5H-naphtho[1,2-b]thiophene-2-carboxylic acid; 4,5-Dihydronaphtho[1,2-b]thiophene-2-carboxylic acid; 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid |
ChEMBL | CHEMBL1421818 |
DrugBank | |
ZINC | ZINC000000069806
|
PDB chain | 7bn8 Chain A Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.1.98: [Wnt protein] O-palmitoleoyl-L-serine hydrolase. |
|
|
|