Structure of PDB 7aqt Chain A Binding Site BS01 |
|
|
Ligand ID | EAM |
InChI | InChI=1S/C22H22ClN5O2/c1-4-24-20(29)12-18-22-27-26-13(2)28(22)19-10-9-16(30-3)11-17(19)21(25-18)14-5-7-15(23)8-6-14/h5-11,18H,4,12H2,1-3H3,(H,24,29)/t18-/m0/s1 |
InChIKey | AAAQFGUYHFJNHI-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc4ccc(C1=NC(c3nnc(n3c2c1cc(OC)cc2)C)CC(=O)NCC)cc4 | OpenEye OEToolkits 1.7.0 | CCNC(=O)CC1c2nnc(n2-c3ccc(cc3C(=N1)c4ccc(cc4)Cl)OC)C | OpenEye OEToolkits 1.7.0 | CCNC(=O)C[C@H]1c2nnc(n2-c3ccc(cc3C(=N1)c4ccc(cc4)Cl)OC)C | CACTVS 3.370 | CCNC(=O)C[CH]1N=C(c2ccc(Cl)cc2)c3cc(OC)ccc3n4c(C)nnc14 | CACTVS 3.370 | CCNC(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c3cc(OC)ccc3n4c(C)nnc14 |
|
Formula | C22 H22 Cl N5 O2 |
Name | 2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-N-ethylacetamide |
ChEMBL | CHEMBL1232461 |
DrugBank | DB16239 |
ZINC | ZINC000058655571
|
PDB chain | 7aqt Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|