Structure of PDB 7ab1 Chain A Binding Site BS01 |
|
|
Ligand ID | C6F |
InChI | InChI=1S/C29H44N8O3/c1-4-23-28(31-20-9-17-40-18-10-20)34-29(26(33-23)27(30)38)32-21-5-6-24(25(19-21)39-3)37-11-7-22(8-12-37)36-15-13-35(2)14-16-36/h5-6,19-20,22H,4,7-18H2,1-3H3,(H2,30,38)(H2,31,32,34) |
InChIKey | GYQYAJJFPNQOOW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCc1nc(C(N)=O)c(Nc2ccc(N3CCC(CC3)N4CCN(C)CC4)c(OC)c2)nc1NC5CCOCC5 | OpenEye OEToolkits 2.0.6 | CCc1c(nc(c(n1)C(=O)N)Nc2ccc(c(c2)OC)N3CCC(CC3)N4CCN(CC4)C)NC5CCOCC5 |
|
Formula | C29 H44 N8 O3 |
Name | 6-ethyl-3-[[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]amino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide; gilteritinib |
ChEMBL | CHEMBL3301622 |
DrugBank | DB12141 |
ZINC | ZINC000113476229
|
PDB chain | 7ab1 Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|