Structure of PDB 6zly Chain A Binding Site BS01 |
|
|
Ligand ID | QMH |
InChI | InChI=1S/C18H27NO4/c1-4-5-6-7-12-23-15-10-8-14(9-11-15)17(20)19-16(13(2)3)18(21)22/h8-11,13,16H,4-7,12H2,1-3H3,(H,19,20)(H,21,22)/t16-/m0/s1 |
InChIKey | ICRSRJPPVADSGE-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCCCCCOc1ccc(cc1)C(=O)N[C@@H](C(C)C)C(=O)O | CACTVS 3.385 | CCCCCCOc1ccc(cc1)C(=O)N[C@@H](C(C)C)C(O)=O | CACTVS 3.385 | CCCCCCOc1ccc(cc1)C(=O)N[CH](C(C)C)C(O)=O | OpenEye OEToolkits 2.0.7 | CCCCCCOc1ccc(cc1)C(=O)NC(C(C)C)C(=O)O |
|
Formula | C18 H27 N O4 |
Name | (2~{S})-2-[(4-hexoxyphenyl)carbonylamino]-3-methyl-butanoic acid |
ChEMBL | CHEMBL4741141 |
DrugBank | |
ZINC |
|
PDB chain | 6zly Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|