Structure of PDB 6zci Chain A Binding Site BS01 |
|
|
Ligand ID | QFN |
InChI | InChI=1S/C22H21ClN4O2/c1-12-10-17(11-25(3)21(12)28)26-19(14-4-6-15(23)7-5-14)18-13(2)24-27(16-8-9-16)20(18)22(26)29/h4-7,10-11,16,19H,8-9H2,1-3H3/t19-/m1/s1 |
InChIKey | PXGREUPWZAUELV-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1c2c(n(n1)C3CC3)C(=O)N(C2c4ccc(cc4)Cl)C5=CN(C(=O)C(=C5)C)C | CACTVS 3.385 | CN1C=C(C=C(C)C1=O)N2[CH](c3ccc(Cl)cc3)c4c(C)nn(C5CC5)c4C2=O | CACTVS 3.385 | CN1C=C(C=C(C)C1=O)N2[C@H](c3ccc(Cl)cc3)c4c(C)nn(C5CC5)c4C2=O | OpenEye OEToolkits 2.0.7 | Cc1c2c(n(n1)C3CC3)C(=O)N([C@@H]2c4ccc(cc4)Cl)C5=CN(C(=O)C(=C5)C)C |
|
Formula | C22 H21 Cl N4 O2 |
Name | (4~{R})-4-(4-chlorophenyl)-1-cyclopropyl-5-(1,5-dimethyl-6-oxidanylidene-pyridin-3-yl)-3-methyl-4~{H}-pyrrolo[3,4-c]pyrazol-6-one |
ChEMBL | CHEMBL3650899 |
DrugBank | |
ZINC | ZINC000220220625
|
PDB chain | 6zci Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|